C23H23NO — CID 101191724
(2R)-2-[benzyl-[(1R)-1-phenylethyl]amino]-2-phenylacetaldehyde (PubChem CID 101191724) has the molecular formula C23H23NO and a molecular weight of 329.44 g/mol. Its IUPAC name is (2R)-2-[benzyl-[(1R)-1-phenylethyl]amino]-2-phenylacetaldehyde.
| Compound Name | (2R)-2-[benzyl-[(1R)-1-phenylethyl]amino]-2-phenylacetaldehyde |
|---|---|
| PubChem CID | 101191724 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (2R)-2-[benzyl-[(1R)-1-phenylethyl]amino]-2-phenylacetaldehyde |
| SMILES | C[C@H](c1ccccc1)N(Cc1ccccc1)[C@@H](C=O)c1ccccc1 |
| InChI | InChI=1S/C23H23NO/c1-19(21-13-7-3-8-14-21)24(17-20-11-5-2-6-12-20)23(18-25)22-15-9-4-10-16-22/h2-16,18-19,23H,17H2,1H3/t19-,23+/m1/s1 |
| InChIKey | BWQWDKYJKMAGON-XXBNENTESA-N |
| XLogP | 5.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|