C28H33NO2 — CID 10364549
(E,3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-1-[(2-methylpropan-2-yl)oxy]-3-phenylprop-1-en-1-ol (PubChem CID 10364549) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (E,3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-1-[(2-methylpropan-2-yl)oxy]-3-phenylprop-1-en-1-ol.
| Compound Name | (E,3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-1-[(2-methylpropan-2-yl)oxy]-3-phenylprop-1-en-1-ol |
|---|---|
| PubChem CID | 10364549 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (E,3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-1-[(2-methylpropan-2-yl)oxy]-3-phenylprop-1-en-1-ol |
| SMILES | C[C@H](c1ccccc1)N(Cc1ccccc1)[C@@H](/C=C(\O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H33NO2/c1-22(24-16-10-6-11-17-24)29(21-23-14-8-5-9-15-23)26(25-18-12-7-13-19-25)20-27(30)31-28(2,3)4/h5-20,22,26,30H,21H2,1-4H3/b27-20+/t22-,26+/m1/s1 |
| InChIKey | RMXNCTQDKRZMHP-WPRXRIOVSA-N |
| XLogP | 7.21 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|