C28H33NO2S — CID 102383915
tert-butyl (2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-phenyl-2-sulfanylpropanoate (PubChem CID 102383915) has the molecular formula C28H33NO2S and a molecular weight of 447.64 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-phenyl-2-sulfanylpropanoate.
| Compound Name | tert-butyl (2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-phenyl-2-sulfanylpropanoate |
|---|---|
| PubChem CID | 102383915 |
| Molecular Formula | C28H33NO2S |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | tert-butyl (2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-phenyl-2-sulfanylpropanoate |
| SMILES | C[C@H](c1ccccc1)N(Cc1ccccc1)[C@H](c1ccccc1)[C@@H](S)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H33NO2S/c1-21(23-16-10-6-11-17-23)29(20-22-14-8-5-9-15-22)25(24-18-12-7-13-19-24)26(32)27(30)31-28(2,3)4/h5-19,21,25-26,32H,20H2,1-4H3/t21-,25-,26-/m1/s1 |
| InChIKey | VSJHLVBSUOWMJB-LPPUWEFUSA-N |
| XLogP | 6.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|