C23H29N3O2 — CID 135405833
tert-butyl (3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-diazobutanoate (PubChem CID 135405833) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl (3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-diazobutanoate.
| Compound Name | tert-butyl (3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-diazobutanoate |
|---|---|
| PubChem CID | 135405833 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | tert-butyl (3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-diazobutanoate |
| SMILES | C[C@@H](C(=[N+]=[N-])C(=O)OC(C)(C)C)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O2/c1-17(20-14-10-7-11-15-20)26(16-19-12-8-6-9-13-19)18(2)21(25-24)22(27)28-23(3,4)5/h6-15,17-18H,16H2,1-5H3/t17-,18-/m0/s1 |
| InChIKey | RUYAIBWAKRBTDF-ROUUACIJSA-N |
| XLogP | 4.65 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|