C29H39NO2 — CID 135033167
tert-butyl (2R,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-prop-2-enylhept-6-enoate (PubChem CID 135033167) has the molecular formula C29H39NO2 and a molecular weight of 433.64 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-prop-2-enylhept-6-enoate.
| Compound Name | tert-butyl (2R,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-prop-2-enylhept-6-enoate |
|---|---|
| PubChem CID | 135033167 |
| Molecular Formula | C29H39NO2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | tert-butyl (2R,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-prop-2-enylhept-6-enoate |
| SMILES | C=CCC[C@@H]([C@@H](CC=C)C(=O)OC(C)(C)C)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C29H39NO2/c1-7-9-21-27(26(16-8-2)28(31)32-29(4,5)6)30(22-24-17-12-10-13-18-24)23(3)25-19-14-11-15-20-25/h7-8,10-15,17-20,23,26-27H,1-2,9,16,21-22H2,3-6H3/t23-,26+,27-/m0/s1 |
| InChIKey | WDKMRBGZZFCBML-RNJDCESWSA-N |
| XLogP | 7.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|