C25H33NO2 — CID 135032794
(2S,3R)-2-[(1S)-1-[benzyl-[(1S)-1-phenylethyl]amino]pent-4-enyl]pent-4-ene-1,3-diol (PubChem CID 135032794) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is (2S,3R)-2-[(1S)-1-[benzyl-[(1S)-1-phenylethyl]amino]pent-4-enyl]pent-4-ene-1,3-diol.
| Compound Name | (2S,3R)-2-[(1S)-1-[benzyl-[(1S)-1-phenylethyl]amino]pent-4-enyl]pent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 135032794 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (2S,3R)-2-[(1S)-1-[benzyl-[(1S)-1-phenylethyl]amino]pent-4-enyl]pent-4-ene-1,3-diol |
| SMILES | C=CCC[C@@H]([C@@H](CO)[C@H](O)C=C)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H33NO2/c1-4-6-17-24(23(19-27)25(28)5-2)26(18-21-13-9-7-10-14-21)20(3)22-15-11-8-12-16-22/h4-5,7-16,20,23-25,27-28H,1-2,6,17-19H2,3H3/t20-,23+,24-,25+/m0/s1 |
| InChIKey | SJQVPZGGPJDJPF-WQDFSMHNSA-N |
| XLogP | 4.74 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|