C37H53NO3Si — CID 71681121
(3R,4R,5R)-5-[benzyl-[(1R)-1-phenylethyl]amino]-4-phenylmethoxy-6-tri(propan-2-yl)silyloxyhex-1-en-3-ol (PubChem CID 71681121) has the molecular formula C37H53NO3Si and a molecular weight of 587.92 g/mol. Its IUPAC name is (3R,4R,5R)-5-[benzyl-[(1R)-1-phenylethyl]amino]-4-phenylmethoxy-6-tri(propan-2-yl)silyloxyhex-1-en-3-ol.
| Compound Name | (3R,4R,5R)-5-[benzyl-[(1R)-1-phenylethyl]amino]-4-phenylmethoxy-6-tri(propan-2-yl)silyloxyhex-1-en-3-ol |
|---|---|
| PubChem CID | 71681121 |
| Molecular Formula | C37H53NO3Si |
| Molecular Weight | 587.92 g/mol |
| Exact Mass | 587.38 |
| IUPAC Name | (3R,4R,5R)-5-[benzyl-[(1R)-1-phenylethyl]amino]-4-phenylmethoxy-6-tri(propan-2-yl)silyloxyhex-1-en-3-ol |
| SMILES | C=C[C@@H](O)[C@H](OCc1ccccc1)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C37H53NO3Si/c1-9-36(39)37(40-26-33-21-15-11-16-22-33)35(27-41-42(28(2)3,29(4)5)30(6)7)38(25-32-19-13-10-14-20-32)31(8)34-23-17-12-18-24-34/h9-24,28-31,35-37,39H,1,25-27H2,2-8H3/t31-,35-,36-,37-/m1/s1 |
| InChIKey | FKRQNOGLAGKPFA-MCNAWRSPSA-N |
| XLogP | 8.94 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.92 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|