C41H68O7Si — CID 53494607
(E,2R,3R,6S,7S,8R,9S,10S)-11-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]-2,6,8,10-tetramethyl-9-phenylmethoxy-1-tri(propan-2-yl)silyloxyundec-4-en-3-ol (PubChem CID 53494607) has the molecular formula C41H68O7Si and a molecular weight of 701.07 g/mol. Its IUPAC name is (E,2R,3R,6S,7S,8R,9S,10S)-11-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]-2,6,8,10-tetramethyl-9-phenylmethoxy-1-tri(propan-2-yl)silyloxyundec-4-en-3-ol.
| Compound Name | (E,2R,3R,6S,7S,8R,9S,10S)-11-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]-2,6,8,10-tetramethyl-9-phenylmethoxy-1-tri(propan-2-yl)silyloxyundec-4-en-3-ol |
|---|---|
| PubChem CID | 53494607 |
| Molecular Formula | C41H68O7Si |
| Molecular Weight | 701.07 g/mol |
| Exact Mass | 700.47 |
| IUPAC Name | (E,2R,3R,6S,7S,8R,9S,10S)-11-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]-2,6,8,10-tetramethyl-9-phenylmethoxy-1-tri(propan-2-yl)silyloxyundec-4-en-3-ol |
| SMILES | COCOC[C@H](C)[C@H](OCc1ccccc1)[C@H](C)[C@@H](OCc1ccc(OC)cc1)[C@@H](C)/C=C/[C@@H](O)[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C41H68O7Si/c1-29(2)49(30(3)4,31(5)6)48-25-33(8)39(42)23-18-32(7)40(46-27-37-19-21-38(44-12)22-20-37)35(10)41(34(9)24-45-28-43-11)47-26-36-16-14-13-15-17-36/h13-23,29-35,39-42H,24-28H2,1-12H3/b23-18+/t32-,33+,34-,35+,39+,40-,41-/m0/s1 |
| InChIKey | GFFGURWYGKBLJC-NYHFYVHLSA-N |
| XLogP | 9.44 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.07 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|