C37H65IO6Si — CID 15946964
[(E,3R,4R)-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,4S,5S,6S,8R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethyl-9-tri(propan-2-yl)silyloxynonanoate (PubChem CID 15946964) has the molecular formula C37H65IO6Si and a molecular weight of 760.91 g/mol. Its IUPAC name is [(E,3R,4R)-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,4S,5S,6S,8R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethyl-9-tri(propan-2-yl)silyloxynonanoate.
| Compound Name | [(E,3R,4R)-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,4S,5S,6S,8R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethyl-9-tri(propan-2-yl)silyloxynonanoate |
|---|---|
| PubChem CID | 15946964 |
| Molecular Formula | C37H65IO6Si |
| Molecular Weight | 760.91 g/mol |
| Exact Mass | 760.36 |
| IUPAC Name | [(E,3R,4R)-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,4S,5S,6S,8R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethyl-9-tri(propan-2-yl)silyloxynonanoate |
| SMILES | CC[C@@H](OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](OCc1ccc(OC)cc1)[C@@H](C)C[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)/C=C/I |
| InChI | InChI=1S/C37H65IO6Si/c1-14-34(28(9)19-20-38)44-37(40)31(12)35(39)30(11)36(42-23-32-15-17-33(41-13)18-16-32)29(10)21-27(8)22-43-45(24(2)3,25(4)5)26(6)7/h15-20,24-31,34-36,39H,14,21-23H2,1-13H3/b20-19+/t27-,28-,29+,30+,31-,34-,35+,36+/m1/s1 |
| InChIKey | LGTYRDMZWYDOQT-VEOVSDLWSA-N |
| XLogP | 9.97 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.91 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|