C12H15IO3 — CID 56651391
(E,2S)-4-iodo-1-[(4-methoxyphenyl)methoxy]but-3-en-2-ol (PubChem CID 56651391) has the molecular formula C12H15IO3 and a molecular weight of 334.15 g/mol. Its IUPAC name is (E,2S)-4-iodo-1-[(4-methoxyphenyl)methoxy]but-3-en-2-ol.
| Compound Name | (E,2S)-4-iodo-1-[(4-methoxyphenyl)methoxy]but-3-en-2-ol |
|---|---|
| PubChem CID | 56651391 |
| Molecular Formula | C12H15IO3 |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | (E,2S)-4-iodo-1-[(4-methoxyphenyl)methoxy]but-3-en-2-ol |
| SMILES | COc1ccc(COC[C@@H](O)/C=C/I)cc1 |
| InChI | InChI=1S/C12H15IO3/c1-15-12-4-2-10(3-5-12)8-16-9-11(14)6-7-13/h2-7,11,14H,8-9H2,1H3/b7-6+/t11-/m0/s1 |
| InChIKey | SOBFWQOKUVAABJ-MLRMMBSGSA-N |
| XLogP | 2.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|