C15H22O3 — CID 101074117
(2R)-1-[(4-methoxyphenyl)methoxy]-2-methylhexan-3-one (PubChem CID 101074117) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2R)-1-[(4-methoxyphenyl)methoxy]-2-methylhexan-3-one.
| Compound Name | (2R)-1-[(4-methoxyphenyl)methoxy]-2-methylhexan-3-one |
|---|---|
| PubChem CID | 101074117 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2R)-1-[(4-methoxyphenyl)methoxy]-2-methylhexan-3-one |
| SMILES | CCCC(=O)[C@H](C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H22O3/c1-4-5-15(16)12(2)10-18-11-13-6-8-14(17-3)9-7-13/h6-9,12H,4-5,10-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | LZOYGBKPVLOJGB-GFCCVEGCSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |