C14H20O3 — CID 58822506
1-[(4-methoxyphenyl)methoxy]-2-methylpentan-3-one (PubChem CID 58822506) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methoxy]-2-methylpentan-3-one.
| Compound Name | 1-[(4-methoxyphenyl)methoxy]-2-methylpentan-3-one |
|---|---|
| PubChem CID | 58822506 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-[(4-methoxyphenyl)methoxy]-2-methylpentan-3-one |
| SMILES | CCC(=O)C(C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H20O3/c1-4-14(15)11(2)9-17-10-12-5-7-13(16-3)8-6-12/h5-8,11H,4,9-10H2,1-3H3 |
| InChIKey | KNLQUQJCBOEJNU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |