C18H26O4 — CID 58822522
5-hydroxy-1-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylhept-6-en-3-one (PubChem CID 58822522) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 5-hydroxy-1-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylhept-6-en-3-one.
| Compound Name | 5-hydroxy-1-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylhept-6-en-3-one |
|---|---|
| PubChem CID | 58822522 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5-hydroxy-1-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylhept-6-en-3-one |
| SMILES | C=C(C)C(O)C(C)C(=O)C(C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H26O4/c1-12(2)17(19)14(4)18(20)13(3)10-22-11-15-6-8-16(21-5)9-7-15/h6-9,13-14,17,19H,1,10-11H2,2-5H3 |
| InChIKey | VMJSGYYRUVDQKF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|