C16H24O4 — CID 11414824
(2S,3S)-4-[(4-methoxyphenyl)methoxy]-2-methyl-2-prop-1-en-2-ylbutane-1,3-diol (PubChem CID 11414824) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (2S,3S)-4-[(4-methoxyphenyl)methoxy]-2-methyl-2-prop-1-en-2-ylbutane-1,3-diol.
| Compound Name | (2S,3S)-4-[(4-methoxyphenyl)methoxy]-2-methyl-2-prop-1-en-2-ylbutane-1,3-diol |
|---|---|
| PubChem CID | 11414824 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (2S,3S)-4-[(4-methoxyphenyl)methoxy]-2-methyl-2-prop-1-en-2-ylbutane-1,3-diol |
| SMILES | C=C(C)[C@@](C)(CO)[C@H](O)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H24O4/c1-12(2)16(3,11-17)15(18)10-20-9-13-5-7-14(19-4)8-6-13/h5-8,15,17-18H,1,9-11H2,2-4H3/t15-,16-/m1/s1 |
| InChIKey | NVKNFHLMQJFBEP-HZPDHXFCSA-N |
| XLogP | 2.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|