C17H28O4 — CID 90293150
(3R,4S)-6-[(4-methoxyphenyl)methoxy]-2,3,4-trimethylhexane-1,5-diol (PubChem CID 90293150) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3R,4S)-6-[(4-methoxyphenyl)methoxy]-2,3,4-trimethylhexane-1,5-diol.
| Compound Name | (3R,4S)-6-[(4-methoxyphenyl)methoxy]-2,3,4-trimethylhexane-1,5-diol |
|---|---|
| PubChem CID | 90293150 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (3R,4S)-6-[(4-methoxyphenyl)methoxy]-2,3,4-trimethylhexane-1,5-diol |
| SMILES | COc1ccc(COCC(O)[C@@H](C)[C@H](C)C(C)CO)cc1 |
| InChI | InChI=1S/C17H28O4/c1-12(9-18)13(2)14(3)17(19)11-21-10-15-5-7-16(20-4)8-6-15/h5-8,12-14,17-19H,9-11H2,1-4H3/t12?,13-,14+,17?/m1/s1 |
| InChIKey | DPRJZTIRVOKUJZ-DLOXAQCQSA-N |
| XLogP | 2.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |