C16H26O6 — CID 11695341
(2S,3R,4S)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-2-methylpentane-1,4-diol (PubChem CID 11695341) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2S,3R,4S)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-2-methylpentane-1,4-diol.
| Compound Name | (2S,3R,4S)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-2-methylpentane-1,4-diol |
|---|---|
| PubChem CID | 11695341 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2S,3R,4S)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-2-methylpentane-1,4-diol |
| SMILES | COCO[C@H]([C@@H](C)CO)[C@@H](O)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H26O6/c1-12(8-17)16(22-11-19-2)15(18)10-21-9-13-4-6-14(20-3)7-5-13/h4-7,12,15-18H,8-11H2,1-3H3/t12-,15-,16+/m0/s1 |
| InChIKey | WQZKBGUVKXASDU-VBNZEHGJSA-N |
| XLogP | 1.19 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|