C17H24O3 — CID 102590404
(2R,3S,4S)-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylhept-5-yn-1-ol (PubChem CID 102590404) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2R,3S,4S)-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylhept-5-yn-1-ol.
| Compound Name | (2R,3S,4S)-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylhept-5-yn-1-ol |
|---|---|
| PubChem CID | 102590404 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2R,3S,4S)-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylhept-5-yn-1-ol |
| SMILES | CC#C[C@H](C)[C@H](OCc1ccc(OC)cc1)[C@H](C)CO |
| InChI | InChI=1S/C17H24O3/c1-5-6-13(2)17(14(3)11-18)20-12-15-7-9-16(19-4)10-8-15/h7-10,13-14,17-18H,11-12H2,1-4H3/t13-,14+,17-/m0/s1 |
| InChIKey | UNUZQINEKHMBSD-VBQJREDUSA-N |
| XLogP | 2.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|