C10H18O2 — CID 74323439
3-methoxy-2,4-dimethylhept-5-yn-1-ol (PubChem CID 74323439) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 3-methoxy-2,4-dimethylhept-5-yn-1-ol.
| Compound Name | 3-methoxy-2,4-dimethylhept-5-yn-1-ol |
|---|---|
| PubChem CID | 74323439 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 3-methoxy-2,4-dimethylhept-5-yn-1-ol |
| SMILES | CC#CC(C)C(OC)C(C)CO |
| InChI | InChI=1S/C10H18O2/c1-5-6-8(2)10(12-4)9(3)7-11/h8-11H,7H2,1-4H3 |
| InChIKey | HKKOHWQRWCWPPL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|