C7H16O3S — CID 89077012
(2R,4S)-2,4-dimethyl-3-sulfanyloxypentane-1,5-diol (PubChem CID 89077012) has the molecular formula C7H16O3S and a molecular weight of 180.27 g/mol. Its IUPAC name is (2R,4S)-2,4-dimethyl-3-sulfanyloxypentane-1,5-diol.
| Compound Name | (2R,4S)-2,4-dimethyl-3-sulfanyloxypentane-1,5-diol |
|---|---|
| PubChem CID | 89077012 |
| Molecular Formula | C7H16O3S |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (2R,4S)-2,4-dimethyl-3-sulfanyloxypentane-1,5-diol |
| SMILES | C[C@H](CO)C(OS)[C@@H](C)CO |
| InChI | InChI=1S/C7H16O3S/c1-5(3-8)7(10-11)6(2)4-9/h5-9,11H,3-4H2,1-2H3/t5-,6+,7? |
| InChIKey | ZXDTUQJORUMUFQ-MEKDEQNOSA-N |
| XLogP | 0.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|