About 2,3-dimethylbutan-1-ol;ethane;fluoromethane
2,3-dimethylbutan-1-ol;ethane;fluoromethane (PubChem CID 143378168) has the molecular formula C11H29FO
and a molecular weight of 196.35 g/mol. Its IUPAC name is 2,3-dimethylbutan-1-ol;ethane;fluoromethane.
Molecular Properties
| Compound Name | 2,3-dimethylbutan-1-ol;ethane;fluoromethane |
| PubChem CID | 143378168 |
| Molecular Formula | C11H29FO |
| Molecular Weight | 196.35 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 2,3-dimethylbutan-1-ol;ethane;fluoromethane |
| SMILES | CC.CC.CC(C)C(C)CO.CF |
| InChI | InChI=1S/C6H14O.2C2H6.CH3F/c1-5(2)6(3)4-7;3*1-2/h5-7H,4H2,1-3H3;2*1-2H3;1H3 |
| InChIKey | UFHUKIMQKNMQGZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethylbutan-1-ol;ethane;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutan-1-ol;ethane;fluoromethane?
The IUPAC name of 2,3-dimethylbutan-1-ol;ethane;fluoromethane (CID 143378168) is 2,3-dimethylbutan-1-ol;ethane;fluoromethane.
What is the SMILES notation for 2,3-dimethylbutan-1-ol;ethane;fluoromethane?
The canonical SMILES for 2,3-dimethylbutan-1-ol;ethane;fluoromethane is CC.CC.CC(C)C(C)CO.CF.
What is the InChIKey of 2,3-dimethylbutan-1-ol;ethane;fluoromethane?
The InChIKey is UFHUKIMQKNMQGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.2C2H6.CH3F/c1-5(2)6(3)4-7;3*1-2/h5-7H,4H2,1-3H3;2*1-2H3;1H3.
What are the key properties of 2,3-dimethylbutan-1-ol;ethane;fluoromethane?
2,3-dimethylbutan-1-ol;ethane;fluoromethane has a molecular weight of 196.35 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutan-1-ol;ethane;fluoromethane is sourced from PubChem (CID 143378168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).