C5H11BrO2 — CID 132937045
(2R,3S)-4-bromo-2-methylbutane-1,3-diol (PubChem CID 132937045) has the molecular formula C5H11BrO2 and a molecular weight of 183.04 g/mol. Its IUPAC name is (2R,3S)-4-bromo-2-methylbutane-1,3-diol.
| Compound Name | (2R,3S)-4-bromo-2-methylbutane-1,3-diol |
|---|---|
| PubChem CID | 132937045 |
| Molecular Formula | C5H11BrO2 |
| Molecular Weight | 183.04 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | (2R,3S)-4-bromo-2-methylbutane-1,3-diol |
| SMILES | C[C@H](CO)[C@H](O)CBr |
| InChI | InChI=1S/C5H11BrO2/c1-4(3-7)5(8)2-6/h4-5,7-8H,2-3H2,1H3/t4-,5-/m1/s1 |
| InChIKey | LDWMGWAXLAKLDV-RFZPGFLSSA-N |
| XLogP | 0.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.04 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|