C5H13O3P — CID 89333114
(2R,3S)-2-methyl-4-phosphanyloxybutane-1,3-diol (PubChem CID 89333114) has the molecular formula C5H13O3P and a molecular weight of 152.13 g/mol. Its IUPAC name is (2R,3S)-2-methyl-4-phosphanyloxybutane-1,3-diol.
| Compound Name | (2R,3S)-2-methyl-4-phosphanyloxybutane-1,3-diol |
|---|---|
| PubChem CID | 89333114 |
| Molecular Formula | C5H13O3P |
| Molecular Weight | 152.13 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | (2R,3S)-2-methyl-4-phosphanyloxybutane-1,3-diol |
| SMILES | C[C@H](CO)[C@H](O)COP |
| InChI | InChI=1S/C5H13O3P/c1-4(2-6)5(7)3-8-9/h4-7H,2-3,9H2,1H3/t4-,5-/m1/s1 |
| InChIKey | DBELDGCVBLVMFK-RFZPGFLSSA-N |
| XLogP | -0.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.13 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|