C8H18O2 — CID 57128275
2,3-dimethylhexane-1,4-diol (PubChem CID 57128275) has the molecular formula C8H18O2 and a molecular weight of 146.23 g/mol. Its IUPAC name is 2,3-dimethylhexane-1,4-diol.
| Compound Name | 2,3-dimethylhexane-1,4-diol |
|---|---|
| PubChem CID | 57128275 |
| Molecular Formula | C8H18O2 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | 2,3-dimethylhexane-1,4-diol |
| SMILES | CCC(O)C(C)C(C)CO |
| InChI | InChI=1S/C8H18O2/c1-4-8(10)7(3)6(2)5-9/h6-10H,4-5H2,1-3H3 |
| InChIKey | MAYREUPTYJOUHK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |