C8H19NO2 — CID 142052298
1-amino-2,3,4-trimethylpentane-1,5-diol (PubChem CID 142052298) has the molecular formula C8H19NO2 and a molecular weight of 161.24 g/mol. Its IUPAC name is 1-amino-2,3,4-trimethylpentane-1,5-diol.
| Compound Name | 1-amino-2,3,4-trimethylpentane-1,5-diol |
|---|---|
| PubChem CID | 142052298 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 1-amino-2,3,4-trimethylpentane-1,5-diol |
| SMILES | CC(CO)C(C)C(C)C(N)O |
| InChI | InChI=1S/C8H19NO2/c1-5(4-10)6(2)7(3)8(9)11/h5-8,10-11H,4,9H2,1-3H3 |
| InChIKey | UEWDNIYZUNCYBF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|