C11H22O2 — CID 122674518
7-hydroxy-3,4,5,6-tetramethylheptan-2-one (PubChem CID 122674518) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 7-hydroxy-3,4,5,6-tetramethylheptan-2-one.
| Compound Name | 7-hydroxy-3,4,5,6-tetramethylheptan-2-one |
|---|---|
| PubChem CID | 122674518 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 7-hydroxy-3,4,5,6-tetramethylheptan-2-one |
| SMILES | CC(=O)C(C)C(C)C(C)C(C)CO |
| InChI | InChI=1S/C11H22O2/c1-7(6-12)8(2)9(3)10(4)11(5)13/h7-10,12H,6H2,1-5H3 |
| InChIKey | QVVBAKHPOIBTMV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |