C11H24O — CID 159485541
2,3-dimethylbutan-1-ol;2-methylbut-2-ene (PubChem CID 159485541) has the molecular formula C11H24O and a molecular weight of 172.31 g/mol. Its IUPAC name is 2,3-dimethylbutan-1-ol;2-methylbut-2-ene.
| Compound Name | 2,3-dimethylbutan-1-ol;2-methylbut-2-ene |
|---|---|
| PubChem CID | 159485541 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 2,3-dimethylbutan-1-ol;2-methylbut-2-ene |
| SMILES | CC(C)C(C)CO.CC=C(C)C |
| InChI | InChI=1S/C6H14O.C5H10/c1-5(2)6(3)4-7;1-4-5(2)3/h5-7H,4H2,1-3H3;4H,1-3H3 |
| InChIKey | LXNMNWDYFYOEMO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|