C18H36O3 — CID 162167407
2,3-dimethylbutan-1-ol;2,3-dimethylbut-2-enal;2,3-dimethylbut-2-en-1-ol (PubChem CID 162167407) has the molecular formula C18H36O3 and a molecular weight of 300.48 g/mol. Its IUPAC name is 2,3-dimethylbutan-1-ol;2,3-dimethylbut-2-enal;2,3-dimethylbut-2-en-1-ol.
| Compound Name | 2,3-dimethylbutan-1-ol;2,3-dimethylbut-2-enal;2,3-dimethylbut-2-en-1-ol |
|---|---|
| PubChem CID | 162167407 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 2,3-dimethylbutan-1-ol;2,3-dimethylbut-2-enal;2,3-dimethylbut-2-en-1-ol |
| SMILES | CC(C)=C(C)C=O.CC(C)=C(C)CO.CC(C)C(C)CO |
| InChI | InChI=1S/C6H14O.C6H12O.C6H10O/c3*1-5(2)6(3)4-7/h5-7H,4H2,1-3H3;7H,4H2,1-3H3;4H,1-3H3 |
| InChIKey | ZNHWWZHKYYPTOL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|