C8H14O2 — CID 87291673
(E)-5-hydroxy-2,3-dimethylhex-2-enal (PubChem CID 87291673) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (E)-5-hydroxy-2,3-dimethylhex-2-enal.
| Compound Name | (E)-5-hydroxy-2,3-dimethylhex-2-enal |
|---|---|
| PubChem CID | 87291673 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (E)-5-hydroxy-2,3-dimethylhex-2-enal |
| SMILES | C/C(C=O)=C(/C)CC(C)O |
| InChI | InChI=1S/C8H14O2/c1-6(4-8(3)10)7(2)5-9/h5,8,10H,4H2,1-3H3/b7-6+ |
| InChIKey | OHPNQHLJUNFDEK-VOTSOKGWSA-N |
| XLogP | 1.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|