About (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal
(E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal (PubChem CID 142238806) has the molecular formula C9H16O2S
and a molecular weight of 188.29 g/mol. Its IUPAC name is (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal.
Molecular Properties
| Compound Name | (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal |
| PubChem CID | 142238806 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal |
| SMILES | C/C(C=O)=C(\S)C(C)CC(C)O |
| InChI | InChI=1S/C9H16O2S/c1-6(4-8(3)11)9(12)7(2)5-10/h5-6,8,11-12H,4H2,1-3H3/b9-7+ |
| InChIKey | HVRABZKWORYQEZ-VQHVLOKHSA-N |
| XLogP | 1.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal?
The IUPAC name of (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal (CID 142238806) is (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal.
What is the SMILES notation for (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal?
The canonical SMILES for (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal is C/C(C=O)=C(\S)C(C)CC(C)O.
What is the InChIKey of (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal?
The InChIKey is HVRABZKWORYQEZ-VQHVLOKHSA-N. The full InChI is InChI=1S/C9H16O2S/c1-6(4-8(3)11)9(12)7(2)5-10/h5-6,8,11-12H,4H2,1-3H3/b9-7+.
What are the key properties of (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal?
(E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal has a molecular weight of 188.29 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal is sourced from PubChem (CID 142238806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).