C9H16O2S — CID 142238806
(E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal (PubChem CID 142238806) has the molecular formula C9H16O2S and a molecular weight of 188.29 g/mol. Its IUPAC name is (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal.
| Compound Name | (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal |
|---|---|
| PubChem CID | 142238806 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (E)-6-hydroxy-2,4-dimethyl-3-sulfanylhept-2-enal |
| SMILES | C/C(C=O)=C(\S)C(C)CC(C)O |
| InChI | InChI=1S/C9H16O2S/c1-6(4-8(3)11)9(12)7(2)5-10/h5-6,8,11-12H,4H2,1-3H3/b9-7+ |
| InChIKey | HVRABZKWORYQEZ-VQHVLOKHSA-N |
| XLogP | 1.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|