C10H18O2 — CID 87292232
(E)-5-hydroxy-2,7-dimethyloct-2-enal (PubChem CID 87292232) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (E)-5-hydroxy-2,7-dimethyloct-2-enal.
| Compound Name | (E)-5-hydroxy-2,7-dimethyloct-2-enal |
|---|---|
| PubChem CID | 87292232 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (E)-5-hydroxy-2,7-dimethyloct-2-enal |
| SMILES | C/C(C=O)=C\CC(O)CC(C)C |
| InChI | InChI=1S/C10H18O2/c1-8(2)6-10(12)5-4-9(3)7-11/h4,7-8,10,12H,5-6H2,1-3H3/b9-4+ |
| InChIKey | IIIDWOMCUAJISY-RUDMXATFSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|