C11H13F5O2 — CID 159692131
5,5-difluoro-2-methylpent-2-enal;2,5,5-trifluoropent-2-enal (PubChem CID 159692131) has the molecular formula C11H13F5O2 and a molecular weight of 272.21 g/mol. Its IUPAC name is 5,5-difluoro-2-methylpent-2-enal;2,5,5-trifluoropent-2-enal.
| Compound Name | 5,5-difluoro-2-methylpent-2-enal;2,5,5-trifluoropent-2-enal |
|---|---|
| PubChem CID | 159692131 |
| Molecular Formula | C11H13F5O2 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5,5-difluoro-2-methylpent-2-enal;2,5,5-trifluoropent-2-enal |
| SMILES | CC(C=O)=CCC(F)F.O=CC(F)=CCC(F)F |
| InChI | InChI=1S/C6H8F2O.C5H5F3O/c1-5(4-9)2-3-6(7)8;6-4(3-9)1-2-5(7)8/h2,4,6H,3H2,1H3;1,3,5H,2H2 |
| InChIKey | MWNZELIQDBPMBR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|