C11H20O2 — CID 87291633
(E)-5-hydroxy-2,6-dimethylnon-2-enal (PubChem CID 87291633) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (E)-5-hydroxy-2,6-dimethylnon-2-enal.
| Compound Name | (E)-5-hydroxy-2,6-dimethylnon-2-enal |
|---|---|
| PubChem CID | 87291633 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (E)-5-hydroxy-2,6-dimethylnon-2-enal |
| SMILES | CCCC(C)C(O)C/C=C(\C)C=O |
| InChI | InChI=1S/C11H20O2/c1-4-5-10(3)11(13)7-6-9(2)8-12/h6,8,10-11,13H,4-5,7H2,1-3H3/b9-6+ |
| InChIKey | OGPFRIBPPIQFHX-RMKNXTFCSA-N |
| XLogP | 2.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|