C13H26 — CID 123818084
3,6,7-trimethyldec-3-ene (PubChem CID 123818084) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is 3,6,7-trimethyldec-3-ene.
| Compound Name | 3,6,7-trimethyldec-3-ene |
|---|---|
| PubChem CID | 123818084 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 3,6,7-trimethyldec-3-ene |
| SMILES | CCCC(C)C(C)CC=C(C)CC |
| InChI | InChI=1S/C13H26/c1-6-8-12(4)13(5)10-9-11(3)7-2/h9,12-13H,6-8,10H2,1-5H3 |
| InChIKey | PNIRBRAMLTYDND-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|