C16H36 — CID 170712386
2,2-dimethylpropane;(Z)-3-methylhex-3-ene;2-methylpropane (PubChem CID 170712386) has the molecular formula C16H36 and a molecular weight of 228.46 g/mol. Its IUPAC name is 2,2-dimethylpropane;(Z)-3-methylhex-3-ene;2-methylpropane.
| Compound Name | 2,2-dimethylpropane;(Z)-3-methylhex-3-ene;2-methylpropane |
|---|---|
| PubChem CID | 170712386 |
| Molecular Formula | C16H36 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 228.28 |
| IUPAC Name | 2,2-dimethylpropane;(Z)-3-methylhex-3-ene;2-methylpropane |
| SMILES | CC(C)(C)C.CC(C)C.CC/C=C(/C)CC |
| InChI | InChI=1S/C7H14.C5H12.C4H10/c1-4-6-7(3)5-2;1-5(2,3)4;1-4(2)3/h6H,4-5H2,1-3H3;1-4H3;4H,1-3H3/b7-6-;; |
| InChIKey | PEMLJSGVUHEIOX-AQTVDGORSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|