C11H22 — CID 167475963
(E)-3,6,7-trimethyloct-3-ene (PubChem CID 167475963) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is (E)-3,6,7-trimethyloct-3-ene.
| Compound Name | (E)-3,6,7-trimethyloct-3-ene |
|---|---|
| PubChem CID | 167475963 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | (E)-3,6,7-trimethyloct-3-ene |
| SMILES | CC/C(C)=C/CC(C)C(C)C |
| InChI | InChI=1S/C11H22/c1-6-10(4)7-8-11(5)9(2)3/h7,9,11H,6,8H2,1-5H3/b10-7+ |
| InChIKey | MYMZBNLQBCIVRZ-JXMROGBWSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|