About 3,4-dimethylpentanethial
3,4-dimethylpentanethial (PubChem CID 54142561) has the molecular formula C7H14S
and a molecular weight of 130.26 g/mol. Its IUPAC name is 3,4-dimethylpentanethial.
Molecular Properties
| Compound Name | 3,4-dimethylpentanethial |
| PubChem CID | 54142561 |
| Molecular Formula | C7H14S |
| Molecular Weight | 130.26 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 3,4-dimethylpentanethial |
| SMILES | CC(C)C(C)CC=S |
| InChI | InChI=1S/C7H14S/c1-6(2)7(3)4-5-8/h5-7H,4H2,1-3H3 |
| InChIKey | QSDOWFIPBZQGCW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylpentanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylpentanethial?
The IUPAC name of 3,4-dimethylpentanethial (CID 54142561) is 3,4-dimethylpentanethial.
What is the SMILES notation for 3,4-dimethylpentanethial?
The canonical SMILES for 3,4-dimethylpentanethial is CC(C)C(C)CC=S.
What is the InChIKey of 3,4-dimethylpentanethial?
The InChIKey is QSDOWFIPBZQGCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14S/c1-6(2)7(3)4-5-8/h5-7H,4H2,1-3H3.
What are the key properties of 3,4-dimethylpentanethial?
3,4-dimethylpentanethial has a molecular weight of 130.26 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylpentanethial is sourced from PubChem (CID 54142561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).