C11H24 — CID 102426642
(3R,5R)-2,3,5,6-tetramethylheptane (PubChem CID 102426642) has the molecular formula C11H24 and a molecular weight of 156.31 g/mol. Its IUPAC name is (3R,5R)-2,3,5,6-tetramethylheptane.
| Compound Name | (3R,5R)-2,3,5,6-tetramethylheptane |
|---|---|
| PubChem CID | 102426642 |
| Molecular Formula | C11H24 |
| Molecular Weight | 156.31 g/mol |
| Exact Mass | 156.19 |
| IUPAC Name | (3R,5R)-2,3,5,6-tetramethylheptane |
| SMILES | CC(C)[C@H](C)C[C@@H](C)C(C)C |
| InChI | InChI=1S/C11H24/c1-8(2)10(5)7-11(6)9(3)4/h8-11H,7H2,1-6H3/t10-,11-/m1/s1 |
| InChIKey | RAHGVMDMAJFLTP-GHMZBOCLSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |