C10H23N — CID 147299389
2-ethyl-4,5-dimethylhexan-1-amine (PubChem CID 147299389) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is 2-ethyl-4,5-dimethylhexan-1-amine.
| Compound Name | 2-ethyl-4,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 147299389 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | 2-ethyl-4,5-dimethylhexan-1-amine |
| SMILES | CCC(CN)CC(C)C(C)C |
| InChI | InChI=1S/C10H23N/c1-5-10(7-11)6-9(4)8(2)3/h8-10H,5-7,11H2,1-4H3 |
| InChIKey | CVTMTIKUCIOXJD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |