C14H30S — CID 123486211
5-(tert-butylsulfanylmethyl)-2,3-dimethylheptane (PubChem CID 123486211) has the molecular formula C14H30S and a molecular weight of 230.46 g/mol. Its IUPAC name is 5-(tert-butylsulfanylmethyl)-2,3-dimethylheptane.
| Compound Name | 5-(tert-butylsulfanylmethyl)-2,3-dimethylheptane |
|---|---|
| PubChem CID | 123486211 |
| Molecular Formula | C14H30S |
| Molecular Weight | 230.46 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | 5-(tert-butylsulfanylmethyl)-2,3-dimethylheptane |
| SMILES | CCC(CSC(C)(C)C)CC(C)C(C)C |
| InChI | InChI=1S/C14H30S/c1-8-13(9-12(4)11(2)3)10-15-14(5,6)7/h11-13H,8-10H2,1-7H3 |
| InChIKey | AKCNXXVYQIKOJF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |