C15H33NS — CID 114200920
1-tert-butylsulfanyl-N-ethyl-4,6-dimethylheptan-2-amine (PubChem CID 114200920) has the molecular formula C15H33NS and a molecular weight of 259.50 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-N-ethyl-4,6-dimethylheptan-2-amine.
| Compound Name | 1-tert-butylsulfanyl-N-ethyl-4,6-dimethylheptan-2-amine |
|---|---|
| PubChem CID | 114200920 |
| Molecular Formula | C15H33NS |
| Molecular Weight | 259.50 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 1-tert-butylsulfanyl-N-ethyl-4,6-dimethylheptan-2-amine |
| SMILES | CCNC(CSC(C)(C)C)CC(C)CC(C)C |
| InChI | InChI=1S/C15H33NS/c1-8-16-14(11-17-15(5,6)7)10-13(4)9-12(2)3/h12-14,16H,8-11H2,1-7H3 |
| InChIKey | PYDNKBBXIZBKQH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |