C10H22 — CID 59882960
(5R)-2,3,5-trimethylheptane (PubChem CID 59882960) has the molecular formula C10H22 and a molecular weight of 142.29 g/mol. Its IUPAC name is (5R)-2,3,5-trimethylheptane.
| Compound Name | (5R)-2,3,5-trimethylheptane |
|---|---|
| PubChem CID | 59882960 |
| Molecular Formula | C10H22 |
| Molecular Weight | 142.29 g/mol |
| Exact Mass | 142.17 |
| IUPAC Name | (5R)-2,3,5-trimethylheptane |
| SMILES | CC[C@@H](C)CC(C)C(C)C |
| InChI | InChI=1S/C10H22/c1-6-9(4)7-10(5)8(2)3/h8-10H,6-7H2,1-5H3/t9-,10?/m1/s1 |
| InChIKey | YKPNYFKOKKKGNM-YHMJZVADSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |