C15H32 — CID 123258187
4-ethyl-2,3,5,7-tetramethylnonane (PubChem CID 123258187) has the molecular formula C15H32 and a molecular weight of 212.42 g/mol. Its IUPAC name is 4-ethyl-2,3,5,7-tetramethylnonane.
| Compound Name | 4-ethyl-2,3,5,7-tetramethylnonane |
|---|---|
| PubChem CID | 123258187 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 4-ethyl-2,3,5,7-tetramethylnonane |
| SMILES | CCC(C)CC(C)C(CC)C(C)C(C)C |
| InChI | InChI=1S/C15H32/c1-8-12(5)10-13(6)15(9-2)14(7)11(3)4/h11-15H,8-10H2,1-7H3 |
| InChIKey | RBOKWQVHVOVXAW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |