About 3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane
3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane (PubChem CID 158873092) has the molecular formula C17H38
and a molecular weight of 242.49 g/mol. Its IUPAC name is 3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane.
Analyze 3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane?
The IUPAC name of 3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane (CID 158873092) is 3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane.
What is the SMILES notation for 3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane?
The canonical SMILES for 3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane is CC(C)C(C)C(C)C.CCC(C(C)C)C(C)C.
What is the InChIKey of 3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane?
The InChIKey is JCBYODVJFHAQPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.C8H18/c1-6-9(7(2)3)8(4)5;1-6(2)8(5)7(3)4/h7-9H,6H2,1-5H3;6-8H,1-5H3.
What are the key properties of 3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane?
3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane has a molecular weight of 242.49 g/mol, XLogP of 6.26, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,4-dimethylpentane;2,3,4-trimethylpentane is sourced from PubChem (CID 158873092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).