C10H22O — CID 79298861
4-ethyl-2,5-dimethylhexan-3-ol (PubChem CID 79298861) has the molecular formula C10H22O and a molecular weight of 158.28 g/mol. Its IUPAC name is 4-ethyl-2,5-dimethylhexan-3-ol.
| Compound Name | 4-ethyl-2,5-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 79298861 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | 4-ethyl-2,5-dimethylhexan-3-ol |
| SMILES | CCC(C(C)C)C(O)C(C)C |
| InChI | InChI=1S/C10H22O/c1-6-9(7(2)3)10(11)8(4)5/h7-11H,6H2,1-5H3 |
| InChIKey | ACLHDGFQOQVYML-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |