C10H22O3 — CID 118683289
2-ethyl-4-propan-2-ylpentane-1,3,5-triol (PubChem CID 118683289) has the molecular formula C10H22O3 and a molecular weight of 190.28 g/mol. Its IUPAC name is 2-ethyl-4-propan-2-ylpentane-1,3,5-triol.
| Compound Name | 2-ethyl-4-propan-2-ylpentane-1,3,5-triol |
|---|---|
| PubChem CID | 118683289 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | 2-ethyl-4-propan-2-ylpentane-1,3,5-triol |
| SMILES | CCC(CO)C(O)C(CO)C(C)C |
| InChI | InChI=1S/C10H22O3/c1-4-8(5-11)10(13)9(6-12)7(2)3/h7-13H,4-6H2,1-3H3 |
| InChIKey | IHGMUQMOVZYZHS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |