C8H18OS — CID 124931968
(2S,3R)-2-ethyl-4-methyl-3-sulfanylpentan-1-ol (PubChem CID 124931968) has the molecular formula C8H18OS and a molecular weight of 162.30 g/mol. Its IUPAC name is (2S,3R)-2-ethyl-4-methyl-3-sulfanylpentan-1-ol.
| Compound Name | (2S,3R)-2-ethyl-4-methyl-3-sulfanylpentan-1-ol |
|---|---|
| PubChem CID | 124931968 |
| Molecular Formula | C8H18OS |
| Molecular Weight | 162.30 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | (2S,3R)-2-ethyl-4-methyl-3-sulfanylpentan-1-ol |
| SMILES | CC[C@@H](CO)[C@H](S)C(C)C |
| InChI | InChI=1S/C8H18OS/c1-4-7(5-9)8(10)6(2)3/h6-10H,4-5H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | XVJIAUDYSLDICO-JGVFFNPUSA-N |
| XLogP | 1.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|