C7H16O2S — CID 57078966
2-ethyl-5-sulfanylpentane-1,3-diol (PubChem CID 57078966) has the molecular formula C7H16O2S and a molecular weight of 164.27 g/mol. Its IUPAC name is 2-ethyl-5-sulfanylpentane-1,3-diol.
| Compound Name | 2-ethyl-5-sulfanylpentane-1,3-diol |
|---|---|
| PubChem CID | 57078966 |
| Molecular Formula | C7H16O2S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-ethyl-5-sulfanylpentane-1,3-diol |
| SMILES | CCC(CO)C(O)CCS |
| InChI | InChI=1S/C7H16O2S/c1-2-6(5-8)7(9)3-4-10/h6-10H,2-5H2,1H3 |
| InChIKey | HBRWZBNIICOSLD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|