C16H36O4 — CID 175336862
2,3-dimethylhexane-2,4-diol;2-ethylhexane-1,3-diol (PubChem CID 175336862) has the molecular formula C16H36O4 and a molecular weight of 292.46 g/mol. Its IUPAC name is 2,3-dimethylhexane-2,4-diol;2-ethylhexane-1,3-diol.
| Compound Name | 2,3-dimethylhexane-2,4-diol;2-ethylhexane-1,3-diol |
|---|---|
| PubChem CID | 175336862 |
| Molecular Formula | C16H36O4 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 2,3-dimethylhexane-2,4-diol;2-ethylhexane-1,3-diol |
| SMILES | CCC(O)C(C)C(C)(C)O.CCCC(O)C(CC)CO |
| InChI | InChI=1S/2C8H18O2/c1-5-7(9)6(2)8(3,4)10;1-3-5-8(10)7(4-2)6-9/h6-7,9-10H,5H2,1-4H3;7-10H,3-6H2,1-2H3 |
| InChIKey | XDMODDANKVUXHK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |