C12H24O4 — CID 174424376
2,3-dimethylhexane-2,4-diol;2-methylprop-2-enoic acid (PubChem CID 174424376) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2,3-dimethylhexane-2,4-diol;2-methylprop-2-enoic acid.
| Compound Name | 2,3-dimethylhexane-2,4-diol;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174424376 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2,3-dimethylhexane-2,4-diol;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCC(O)C(C)C(C)(C)O |
| InChI | InChI=1S/C8H18O2.C4H6O2/c1-5-7(9)6(2)8(3,4)10;1-3(2)4(5)6/h6-7,9-10H,5H2,1-4H3;1H2,2H3,(H,5,6) |
| InChIKey | XLRMJPHLNGXFSD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|