C16H29IO6 — CID 139298704
1-iodo-2,2,4-trimethylpentane-1,1-diol;bis(2-methylprop-2-enoic acid) (PubChem CID 139298704) has the molecular formula C16H29IO6 and a molecular weight of 444.31 g/mol. Its IUPAC name is 1-iodo-2,2,4-trimethylpentane-1,1-diol;bis(2-methylprop-2-enoic acid).
| Compound Name | 1-iodo-2,2,4-trimethylpentane-1,1-diol;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 139298704 |
| Molecular Formula | C16H29IO6 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1-iodo-2,2,4-trimethylpentane-1,1-diol;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.CC(C)CC(C)(C)C(O)(O)I |
| InChI | InChI=1S/C8H17IO2.2C4H6O2/c1-6(2)5-7(3,4)8(9,10)11;2*1-3(2)4(5)6/h6,10-11H,5H2,1-4H3;2*1H2,2H3,(H,5,6) |
| InChIKey | MCQVVDSEPNPANR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|